C18H13F3O4S — CID 134911484
2,6-diphenylpyrylium;trifluoromethanesulfonate (PubChem CID 134911484) has the molecular formula C18H13F3O4S and a molecular weight of 382.36 g/mol. Its IUPAC name is 2,6-diphenylpyrylium;trifluoromethanesulfonate.
| Compound Name | 2,6-diphenylpyrylium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134911484 |
| Molecular Formula | C18H13F3O4S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 2,6-diphenylpyrylium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc(-c2cccc(-c3ccccc3)[o+]2)cc1 |
| InChI | InChI=1S/C17H13O.CHF3O3S/c1-3-8-14(9-4-1)16-12-7-13-17(18-16)15-10-5-2-6-11-15;2-1(3,4)8(5,6)7/h1-13H;(H,5,6,7)/q+1;/p-1 |
| InChIKey | BOAHFWGHDBMVSY-UHFFFAOYSA-M |
| XLogP | 4.95 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|