C12H8ClNO3 — CID 134911704
8-chloro-3,7-dimethylchromeno[3,4-d][1,2]oxazol-4-one (PubChem CID 134911704) has the molecular formula C12H8ClNO3 and a molecular weight of 249.65 g/mol. Its IUPAC name is 8-chloro-3,7-dimethylchromeno[3,4-d][1,2]oxazol-4-one.
| Compound Name | 8-chloro-3,7-dimethylchromeno[3,4-d][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 134911704 |
| Molecular Formula | C12H8ClNO3 |
| Molecular Weight | 249.65 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 8-chloro-3,7-dimethylchromeno[3,4-d][1,2]oxazol-4-one |
| SMILES | Cc1cc2oc(=O)c3c(C)noc3c2cc1Cl |
| InChI | InChI=1S/C12H8ClNO3/c1-5-3-9-7(4-8(5)13)11-10(12(15)16-9)6(2)14-17-11/h3-4H,1-2H3 |
| InChIKey | UZZLDHRVOOIZGZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|