C12H9NO3 — CID 13332479
3,7-dimethylchromeno[3,4-d][1,2]oxazol-4-one (PubChem CID 13332479) has the molecular formula C12H9NO3 and a molecular weight of 215.21 g/mol. Its IUPAC name is 3,7-dimethylchromeno[3,4-d][1,2]oxazol-4-one.
| Compound Name | 3,7-dimethylchromeno[3,4-d][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 13332479 |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 3,7-dimethylchromeno[3,4-d][1,2]oxazol-4-one |
| SMILES | Cc1ccc2c(c1)oc(=O)c1c(C)noc12 |
| InChI | InChI=1S/C12H9NO3/c1-6-3-4-8-9(5-6)15-12(14)10-7(2)13-16-11(8)10/h3-5H,1-2H3 |
| InChIKey | MDEIBWHQOSPAMI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|