C16H15N5O4S — CID 134912402
2-diazo-N,N-dimethyl-N'-(4-nitrophenyl)sulfonyl-2-phenylethanimidamide (PubChem CID 134912402) has the molecular formula C16H15N5O4S and a molecular weight of 373.39 g/mol. Its IUPAC name is 2-diazo-N,N-dimethyl-N'-(4-nitrophenyl)sulfonyl-2-phenylethanimidamide.
| Compound Name | 2-diazo-N,N-dimethyl-N'-(4-nitrophenyl)sulfonyl-2-phenylethanimidamide |
|---|---|
| PubChem CID | 134912402 |
| Molecular Formula | C16H15N5O4S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-diazo-N,N-dimethyl-N'-(4-nitrophenyl)sulfonyl-2-phenylethanimidamide |
| SMILES | CN(C)/C(=N\S(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C16H15N5O4S/c1-20(2)16(15(18-17)12-6-4-3-5-7-12)19-26(24,25)14-10-8-13(9-11-14)21(22)23/h3-11H,1-2H3/b19-16- |
| InChIKey | VJLJLZLYXCAWHS-MNDPQUGUSA-N |
| XLogP | 1.96 |
| TPSA | 129.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|