C17H20ClN5O3 — CID 134915064
ethyl 4-[(Z)-1-[(4-chlorophenyl)carbamoylamino]-2-cyanoethenyl]piperazine-1-carboxylate (PubChem CID 134915064) has the molecular formula C17H20ClN5O3 and a molecular weight of 377.83 g/mol. Its IUPAC name is ethyl 4-[(Z)-1-[(4-chlorophenyl)carbamoylamino]-2-cyanoethenyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(Z)-1-[(4-chlorophenyl)carbamoylamino]-2-cyanoethenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134915064 |
| Molecular Formula | C17H20ClN5O3 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | ethyl 4-[(Z)-1-[(4-chlorophenyl)carbamoylamino]-2-cyanoethenyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=C\C#N)NC(=O)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H20ClN5O3/c1-2-26-17(25)23-11-9-22(10-12-23)15(7-8-19)21-16(24)20-14-5-3-13(18)4-6-14/h3-7H,2,9-12H2,1H3,(H2,20,21,24)/b15-7- |
| InChIKey | CGJRPCSQZYAUQU-CHHVJCJISA-N |
| XLogP | 2.60 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|