C16H13NO4S — CID 134915465
ethyl 8-amino-6-oxothiepino[2,3-c]chromene-9-carboxylate (PubChem CID 134915465) has the molecular formula C16H13NO4S and a molecular weight of 315.35 g/mol. Its IUPAC name is ethyl 8-amino-6-oxothiepino[2,3-c]chromene-9-carboxylate.
| Compound Name | ethyl 8-amino-6-oxothiepino[2,3-c]chromene-9-carboxylate |
|---|---|
| PubChem CID | 134915465 |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | ethyl 8-amino-6-oxothiepino[2,3-c]chromene-9-carboxylate |
| SMILES | CCOC(=O)C1=C(N)Sc2c(c3ccccc3oc2=O)C=C1 |
| InChI | InChI=1S/C16H13NO4S/c1-2-20-15(18)11-8-7-10-9-5-3-4-6-12(9)21-16(19)13(10)22-14(11)17/h3-8H,2,17H2,1H3 |
| InChIKey | QUXPNUDPGURKAH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|