C18H23NO5 — CID 134916344
[1-[(3S)-3-[(4-methoxyphenyl)methoxy]-2-methylidenebutyl]-4-oxoazetidin-2-yl] acetate (PubChem CID 134916344) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is [1-[(3S)-3-[(4-methoxyphenyl)methoxy]-2-methylidenebutyl]-4-oxoazetidin-2-yl] acetate.
| Compound Name | [1-[(3S)-3-[(4-methoxyphenyl)methoxy]-2-methylidenebutyl]-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 134916344 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [1-[(3S)-3-[(4-methoxyphenyl)methoxy]-2-methylidenebutyl]-4-oxoazetidin-2-yl] acetate |
| SMILES | C=C(CN1C(=O)CC1OC(C)=O)[C@H](C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H23NO5/c1-12(10-19-17(21)9-18(19)24-14(3)20)13(2)23-11-15-5-7-16(22-4)8-6-15/h5-8,13,18H,1,9-11H2,2-4H3/t13-,18?/m0/s1 |
| InChIKey | XJAQTPJJHUEZTE-FVRDMJKUSA-N |
| XLogP | 2.28 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|