About but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate
but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate (PubChem CID 10800127) has the molecular formula C11H15NO5
and a molecular weight of 241.24 g/mol. Its IUPAC name is but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate.
Molecular Properties
| Compound Name | but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate |
| PubChem CID | 10800127 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate |
| SMILES | C=CCCOC(=O)CN1C(=O)CC1OC(C)=O |
| InChI | InChI=1S/C11H15NO5/c1-3-4-5-16-11(15)7-12-9(14)6-10(12)17-8(2)13/h3,10H,1,4-7H2,2H3 |
| InChIKey | RFCVMUWAFLVAQA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate?
The IUPAC name of but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate (CID 10800127) is but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate.
What is the SMILES notation for but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate?
The canonical SMILES for but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate is C=CCCOC(=O)CN1C(=O)CC1OC(C)=O.
What is the InChIKey of but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate?
The InChIKey is RFCVMUWAFLVAQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO5/c1-3-4-5-16-11(15)7-12-9(14)6-10(12)17-8(2)13/h3,10H,1,4-7H2,2H3.
What are the key properties of but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate?
but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate has a molecular weight of 241.24 g/mol, XLogP of 0.23, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl 2-(2-acetyloxy-4-oxoazetidin-1-yl)acetate is sourced from PubChem (CID 10800127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).