C18H23N3O9 — CID 162165113
propyl 2-[2,4,6-trioxo-3,5-bis(2-oxo-2-prop-2-enoxyethyl)-1,3,5-triazinan-1-yl]acetate (PubChem CID 162165113) has the molecular formula C18H23N3O9 and a molecular weight of 425.39 g/mol. Its IUPAC name is propyl 2-[2,4,6-trioxo-3,5-bis(2-oxo-2-prop-2-enoxyethyl)-1,3,5-triazinan-1-yl]acetate.
| Compound Name | propyl 2-[2,4,6-trioxo-3,5-bis(2-oxo-2-prop-2-enoxyethyl)-1,3,5-triazinan-1-yl]acetate |
|---|---|
| PubChem CID | 162165113 |
| Molecular Formula | C18H23N3O9 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | propyl 2-[2,4,6-trioxo-3,5-bis(2-oxo-2-prop-2-enoxyethyl)-1,3,5-triazinan-1-yl]acetate |
| SMILES | C=CCOC(=O)Cn1c(=O)n(CC(=O)OCC=C)c(=O)n(CC(=O)OCCC)c1=O |
| InChI | InChI=1S/C18H23N3O9/c1-4-7-28-13(22)10-19-16(25)20(11-14(23)29-8-5-2)18(27)21(17(19)26)12-15(24)30-9-6-3/h4-5H,1-2,6-12H2,3H3 |
| InChIKey | ZNACXFTZMAFMKX-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|