C14H20N2O2 — CID 134917371
(4-methylphenyl) N'-acetyl-N,N-diethylcarbamimidate (PubChem CID 134917371) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is (4-methylphenyl) N'-acetyl-N,N-diethylcarbamimidate.
| Compound Name | (4-methylphenyl) N'-acetyl-N,N-diethylcarbamimidate |
|---|---|
| PubChem CID | 134917371 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (4-methylphenyl) N'-acetyl-N,N-diethylcarbamimidate |
| SMILES | CCN(CC)/C(=N\C(C)=O)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C14H20N2O2/c1-5-16(6-2)14(15-12(4)17)18-13-9-7-11(3)8-10-13/h7-10H,5-6H2,1-4H3/b15-14+ |
| InChIKey | JTJODIAXJBPOOP-CCEZHUSRSA-N |
| XLogP | 2.62 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|