C17H19NO4 — CID 134918353
1-O-benzyl 2-O-methyl 4-methylidene-3,5-dihydro-2H-azepine-1,2-dicarboxylate (PubChem CID 134918353) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl 4-methylidene-3,5-dihydro-2H-azepine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl 4-methylidene-3,5-dihydro-2H-azepine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134918353 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1-O-benzyl 2-O-methyl 4-methylidene-3,5-dihydro-2H-azepine-1,2-dicarboxylate |
| SMILES | C=C1CC=CN(C(=O)OCc2ccccc2)C(C(=O)OC)C1 |
| InChI | InChI=1S/C17H19NO4/c1-13-7-6-10-18(15(11-13)16(19)21-2)17(20)22-12-14-8-4-3-5-9-14/h3-6,8-10,15H,1,7,11-12H2,2H3 |
| InChIKey | LYUBYRFWCSDVRX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|