C18H31NO4S — CID 134918616
(R)-4-methyl-N-[(2R)-1,1,1-triethoxy-2-methylbutan-2-yl]benzenesulfinamide (PubChem CID 134918616) has the molecular formula C18H31NO4S and a molecular weight of 357.52 g/mol. Its IUPAC name is (R)-4-methyl-N-[(2R)-1,1,1-triethoxy-2-methylbutan-2-yl]benzenesulfinamide.
| Compound Name | (R)-4-methyl-N-[(2R)-1,1,1-triethoxy-2-methylbutan-2-yl]benzenesulfinamide |
|---|---|
| PubChem CID | 134918616 |
| Molecular Formula | C18H31NO4S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | (R)-4-methyl-N-[(2R)-1,1,1-triethoxy-2-methylbutan-2-yl]benzenesulfinamide |
| SMILES | CCOC(OCC)(OCC)[C@@](C)(CC)N[S@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H31NO4S/c1-7-17(6,18(21-8-2,22-9-3)23-10-4)19-24(20)16-13-11-15(5)12-14-16/h11-14,19H,7-10H2,1-6H3/t17-,24-/m1/s1 |
| InChIKey | AKNCRPIAENHVNR-MZNJEOGPSA-N |
| XLogP | 3.54 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|