About (S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide
(S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide (PubChem CID 25193676) has the molecular formula C23H25NOS2
and a molecular weight of 395.59 g/mol. Its IUPAC name is (S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide.
Molecular Properties
| Compound Name | (S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide |
| PubChem CID | 25193676 |
| Molecular Formula | C23H25NOS2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide |
| SMILES | CS[C@H](c1ccccc1)[C@](C)(N[S@@](=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H25NOS2/c1-18-14-16-21(17-15-18)27(25)24-23(2,20-12-8-5-9-13-20)22(26-3)19-10-6-4-7-11-19/h4-17,22,24H,1-3H3/t22-,23-,27+/m1/s1 |
| InChIKey | RLJWLFZFCNTMPG-NOTUOJBMSA-N |
| XLogP | 5.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide?
The IUPAC name of (S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide (CID 25193676) is (S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide.
What is the SMILES notation for (S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide?
The canonical SMILES for (S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide is CS[C@H](c1ccccc1)[C@](C)(N[S@@](=O)c1ccc(C)cc1)c1ccccc1.
What is the InChIKey of (S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide?
The InChIKey is RLJWLFZFCNTMPG-NOTUOJBMSA-N. The full InChI is InChI=1S/C23H25NOS2/c1-18-14-16-21(17-15-18)27(25)24-23(2,20-12-8-5-9-13-20)22(26-3)19-10-6-4-7-11-19/h4-17,22,24H,1-3H3/t22-,23-,27+/m1/s1.
What are the key properties of (S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide?
(S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide has a molecular weight of 395.59 g/mol, XLogP of 5.63, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-4-methyl-N-[(1R,2R)-1-methylsulfanyl-1,2-diphenylpropan-2-yl]benzenesulfinamide is sourced from PubChem (CID 25193676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).