C20H23NO2 — CID 134920007
phenyl N-cyclohexyl-4-methoxybenzenecarboximidate (PubChem CID 134920007) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is phenyl N-cyclohexyl-4-methoxybenzenecarboximidate.
| Compound Name | phenyl N-cyclohexyl-4-methoxybenzenecarboximidate |
|---|---|
| PubChem CID | 134920007 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | phenyl N-cyclohexyl-4-methoxybenzenecarboximidate |
| SMILES | COc1ccc(/C(=N\C2CCCCC2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO2/c1-22-18-14-12-16(13-15-18)20(21-17-8-4-2-5-9-17)23-19-10-6-3-7-11-19/h3,6-7,10-15,17H,2,4-5,8-9H2,1H3/b21-20+ |
| InChIKey | LZPVHCYSFXHHDW-QZQOTICOSA-N |
| XLogP | 4.85 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|