About (2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide
(2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide (PubChem CID 177498957) has the molecular formula C15H21N3O3
and a molecular weight of 291.35 g/mol. Its IUPAC name is (2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide.
Molecular Properties
| Compound Name | (2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide |
| PubChem CID | 177498957 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide |
| SMILES | COc1ccc(C(=N/O)/C(=N/C2CCCCC2)NO)cc1 |
| InChI | InChI=1S/C15H21N3O3/c1-21-13-9-7-11(8-10-13)14(17-19)15(18-20)16-12-5-3-2-4-6-12/h7-10,12,19-20H,2-6H2,1H3,(H,16,18)/b17-14- |
| InChIKey | JHVGUCVYNNBNOW-VKAVYKQESA-N |
| XLogP | 2.58 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide?
The IUPAC name of (2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide (CID 177498957) is (2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide.
What is the SMILES notation for (2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide?
The canonical SMILES for (2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide is COc1ccc(C(=N/O)/C(=N/C2CCCCC2)NO)cc1.
What is the InChIKey of (2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide?
The InChIKey is JHVGUCVYNNBNOW-VKAVYKQESA-N. The full InChI is InChI=1S/C15H21N3O3/c1-21-13-9-7-11(8-10-13)14(17-19)15(18-20)16-12-5-3-2-4-6-12/h7-10,12,19-20H,2-6H2,1H3,(H,16,18)/b17-14-.
What are the key properties of (2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide?
(2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide has a molecular weight of 291.35 g/mol, XLogP of 2.58, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N'-cyclohexyl-N-hydroxy-2-hydroxyimino-2-(4-methoxyphenyl)ethanimidamide is sourced from PubChem (CID 177498957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).