C20H25NO2Se — CID 134920485
(2S,3R)-N-tert-butyl-3-hydroxy-3-phenyl-2-(phenylselanylmethyl)propanamide (PubChem CID 134920485) has the molecular formula C20H25NO2Se and a molecular weight of 390.39 g/mol. Its IUPAC name is (2S,3R)-N-tert-butyl-3-hydroxy-3-phenyl-2-(phenylselanylmethyl)propanamide.
| Compound Name | (2S,3R)-N-tert-butyl-3-hydroxy-3-phenyl-2-(phenylselanylmethyl)propanamide |
|---|---|
| PubChem CID | 134920485 |
| Molecular Formula | C20H25NO2Se |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (2S,3R)-N-tert-butyl-3-hydroxy-3-phenyl-2-(phenylselanylmethyl)propanamide |
| SMILES | CC(C)(C)NC(=O)[C@@H](C[Se]c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H25NO2Se/c1-20(2,3)21-19(23)17(14-24-16-12-8-5-9-13-16)18(22)15-10-6-4-7-11-15/h4-13,17-18,22H,14H2,1-3H3,(H,21,23)/t17-,18-/m0/s1 |
| InChIKey | YTUORDPPHNJLAE-ROUUACIJSA-N |
| XLogP | 2.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|