C17H14O4 — CID 134920494
(1S,9R,10S)-1-methoxy-10-phenyl-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one (PubChem CID 134920494) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is (1S,9R,10S)-1-methoxy-10-phenyl-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one.
| Compound Name | (1S,9R,10S)-1-methoxy-10-phenyl-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 134920494 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (1S,9R,10S)-1-methoxy-10-phenyl-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
| SMILES | CO[C@@]12O[C@@H](C(=O)c3ccccc31)[C@H](c1ccccc1)O2 |
| InChI | InChI=1S/C17H14O4/c1-19-17-13-10-6-5-9-12(13)14(18)16(21-17)15(20-17)11-7-3-2-4-8-11/h2-10,15-16H,1H3/t15-,16-,17-/m0/s1 |
| InChIKey | TXBRKJDKUBQJFA-ULQDDVLXSA-N |
| XLogP | 2.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |