C23H35N3OS — CID 134920731
3-benzyl-4,5-bis(diethylamino)-6-ethylsulfanyl-1-methylpyridin-2-one (PubChem CID 134920731) has the molecular formula C23H35N3OS and a molecular weight of 401.62 g/mol. Its IUPAC name is 3-benzyl-4,5-bis(diethylamino)-6-ethylsulfanyl-1-methylpyridin-2-one.
| Compound Name | 3-benzyl-4,5-bis(diethylamino)-6-ethylsulfanyl-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 134920731 |
| Molecular Formula | C23H35N3OS |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 3-benzyl-4,5-bis(diethylamino)-6-ethylsulfanyl-1-methylpyridin-2-one |
| SMILES | CCSc1c(N(CC)CC)c(N(CC)CC)c(Cc2ccccc2)c(=O)n1C |
| InChI | InChI=1S/C23H35N3OS/c1-7-25(8-2)20-19(17-18-15-13-12-14-16-18)22(27)24(6)23(28-11-5)21(20)26(9-3)10-4/h12-16H,7-11,17H2,1-6H3 |
| InChIKey | BVGAKQLOMILTRE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |