C21H31N3O — CID 134920997
3-benzyl-4,5-bis(diethylamino)-1-methylpyridin-2-one (PubChem CID 134920997) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is 3-benzyl-4,5-bis(diethylamino)-1-methylpyridin-2-one.
| Compound Name | 3-benzyl-4,5-bis(diethylamino)-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 134920997 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 3-benzyl-4,5-bis(diethylamino)-1-methylpyridin-2-one |
| SMILES | CCN(CC)c1cn(C)c(=O)c(Cc2ccccc2)c1N(CC)CC |
| InChI | InChI=1S/C21H31N3O/c1-6-23(7-2)19-16-22(5)21(25)18(20(19)24(8-3)9-4)15-17-13-11-10-12-14-17/h10-14,16H,6-9,15H2,1-5H3 |
| InChIKey | BASWIGADGMVVHS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |