C17H22N3O3- — CID 134118669
5-[[4-(diethylamino)phenyl]methyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate (PubChem CID 134118669) has the molecular formula C17H22N3O3- and a molecular weight of 316.38 g/mol. Its IUPAC name is 5-[[4-(diethylamino)phenyl]methyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate.
| Compound Name | 5-[[4-(diethylamino)phenyl]methyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate |
|---|---|
| PubChem CID | 134118669 |
| Molecular Formula | C17H22N3O3- |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 5-[[4-(diethylamino)phenyl]methyl]-1,3-dimethyl-2,6-dioxopyrimidin-4-olate |
| SMILES | CCN(CC)c1ccc(Cc2c([O-])n(C)c(=O)n(C)c2=O)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-5-20(6-2)13-9-7-12(8-10-13)11-14-15(21)18(3)17(23)19(4)16(14)22/h7-10,21H,5-6,11H2,1-4H3/p-1 |
| InChIKey | RHLRFAXKAKPPLY-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|