C10H14BrNO6 — CID 134921051
(3aR,5R,6S,6aR)-5-[(Z)-2-bromo-2-nitroethenyl]-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 134921051) has the molecular formula C10H14BrNO6 and a molecular weight of 324.13 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-[(Z)-2-bromo-2-nitroethenyl]-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-[(Z)-2-bromo-2-nitroethenyl]-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 134921051 |
| Molecular Formula | C10H14BrNO6 |
| Molecular Weight | 324.13 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-[(Z)-2-bromo-2-nitroethenyl]-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1/C=C(\Br)[N+](=O)[O-] |
| InChI | InChI=1S/C10H14BrNO6/c1-10(2)17-8-7(15-3)5(16-9(8)18-10)4-6(11)12(13)14/h4-5,7-9H,1-3H3/b6-4+/t5-,7+,8-,9-/m1/s1 |
| InChIKey | RYWZUQMAORPJGN-PRZLOYNFSA-N |
| XLogP | 1.39 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.13 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|