C14H23O10P — CID 100982034
methyl (E)-3-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-dimethoxyphosphoryloxyprop-2-enoate (PubChem CID 100982034) has the molecular formula C14H23O10P and a molecular weight of 382.30 g/mol. Its IUPAC name is methyl (E)-3-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-dimethoxyphosphoryloxyprop-2-enoate.
| Compound Name | methyl (E)-3-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-dimethoxyphosphoryloxyprop-2-enoate |
|---|---|
| PubChem CID | 100982034 |
| Molecular Formula | C14H23O10P |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | methyl (E)-3-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-dimethoxyphosphoryloxyprop-2-enoate |
| SMILES | COC(=O)/C(=C\[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC)OP(=O)(OC)OC |
| InChI | InChI=1S/C14H23O10P/c1-14(2)22-11-10(17-3)8(21-13(11)23-14)7-9(12(15)18-4)24-25(16,19-5)20-6/h7-8,10-11,13H,1-6H3/b9-7+/t8-,10+,11-,13-/m1/s1 |
| InChIKey | BUHLBQAKZPQTME-NTGUOKKMSA-N |
| XLogP | 1.35 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|