C13H19N3O7 — CID 56964941
(1R)-1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-nitroimidazol-1-yl)ethanol (PubChem CID 56964941) has the molecular formula C13H19N3O7 and a molecular weight of 329.31 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-nitroimidazol-1-yl)ethanol.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-nitroimidazol-1-yl)ethanol |
|---|---|
| PubChem CID | 56964941 |
| Molecular Formula | C13H19N3O7 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-nitroimidazol-1-yl)ethanol |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H](O)Cn1cnc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H19N3O7/c1-13(2)22-11-10(20-3)9(21-12(11)23-13)7(17)4-15-5-8(14-6-15)16(18)19/h5-7,9-12,17H,4H2,1-3H3/t7-,9-,10+,11-,12-/m1/s1 |
| InChIKey | GOXZSVMDRBJSRB-DVYMNCLGSA-N |
| XLogP | 0.04 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|