C19H13Cl2N3O — CID 134921628
2-[3-benzyl-5-(2,6-dichlorophenyl)-1,3-oxazolidin-2-ylidene]propanedinitrile (PubChem CID 134921628) has the molecular formula C19H13Cl2N3O and a molecular weight of 370.24 g/mol. Its IUPAC name is 2-[3-benzyl-5-(2,6-dichlorophenyl)-1,3-oxazolidin-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-benzyl-5-(2,6-dichlorophenyl)-1,3-oxazolidin-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 134921628 |
| Molecular Formula | C19H13Cl2N3O |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 2-[3-benzyl-5-(2,6-dichlorophenyl)-1,3-oxazolidin-2-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1OC(c2c(Cl)cccc2Cl)CN1Cc1ccccc1 |
| InChI | InChI=1S/C19H13Cl2N3O/c20-15-7-4-8-16(21)18(15)17-12-24(11-13-5-2-1-3-6-13)19(25-17)14(9-22)10-23/h1-8,17H,11-12H2 |
| InChIKey | JGAOORRWGJCCNF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|