C14H12ClN3O — CID 134921625
2-[5-(4-chlorophenyl)-3-ethyl-1,3-oxazolidin-2-ylidene]propanedinitrile (PubChem CID 134921625) has the molecular formula C14H12ClN3O and a molecular weight of 273.72 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-3-ethyl-1,3-oxazolidin-2-ylidene]propanedinitrile.
| Compound Name | 2-[5-(4-chlorophenyl)-3-ethyl-1,3-oxazolidin-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 134921625 |
| Molecular Formula | C14H12ClN3O |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-3-ethyl-1,3-oxazolidin-2-ylidene]propanedinitrile |
| SMILES | CCN1CC(c2ccc(Cl)cc2)OC1=C(C#N)C#N |
| InChI | InChI=1S/C14H12ClN3O/c1-2-18-9-13(10-3-5-12(15)6-4-10)19-14(18)11(7-16)8-17/h3-6,13H,2,9H2,1H3 |
| InChIKey | VNXVKCOPMUGWPW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|