C12H21NS — CID 134921721
(2Z)-N,N,3-triethyl-2-methylpenta-2,4-dienethioamide (PubChem CID 134921721) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is (2Z)-N,N,3-triethyl-2-methylpenta-2,4-dienethioamide.
| Compound Name | (2Z)-N,N,3-triethyl-2-methylpenta-2,4-dienethioamide |
|---|---|
| PubChem CID | 134921721 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (2Z)-N,N,3-triethyl-2-methylpenta-2,4-dienethioamide |
| SMILES | C=C/C(CC)=C(/C)C(=S)N(CC)CC |
| InChI | InChI=1S/C12H21NS/c1-6-11(7-2)10(5)12(14)13(8-3)9-4/h6H,1,7-9H2,2-5H3/b11-10+ |
| InChIKey | QVHMTXVOUFZYQU-ZHACJKMWSA-N |
| XLogP | 3.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|