C11H19NS — CID 134921720
(2Z)-N,N-diethyl-2,3-dimethylpenta-2,4-dienethioamide (PubChem CID 134921720) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is (2Z)-N,N-diethyl-2,3-dimethylpenta-2,4-dienethioamide.
| Compound Name | (2Z)-N,N-diethyl-2,3-dimethylpenta-2,4-dienethioamide |
|---|---|
| PubChem CID | 134921720 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (2Z)-N,N-diethyl-2,3-dimethylpenta-2,4-dienethioamide |
| SMILES | C=C/C(C)=C(/C)C(=S)N(CC)CC |
| InChI | InChI=1S/C11H19NS/c1-6-9(4)10(5)11(13)12(7-2)8-3/h6H,1,7-8H2,2-5H3/b10-9- |
| InChIKey | LYIVSKJIYFAKJV-KTKRTIGZSA-N |
| XLogP | 3.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|