C11H21NS — CID 142250385
(2E)-2-ethenyl-N,N,3-trimethylpenta-2,4-dien-1-amine;methanethiol (PubChem CID 142250385) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is (2E)-2-ethenyl-N,N,3-trimethylpenta-2,4-dien-1-amine;methanethiol.
| Compound Name | (2E)-2-ethenyl-N,N,3-trimethylpenta-2,4-dien-1-amine;methanethiol |
|---|---|
| PubChem CID | 142250385 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (2E)-2-ethenyl-N,N,3-trimethylpenta-2,4-dien-1-amine;methanethiol |
| SMILES | C=C/C(C)=C(\C=C)CN(C)C.CS |
| InChI | InChI=1S/C10H17N.CH4S/c1-6-9(3)10(7-2)8-11(4)5;1-2/h6-7H,1-2,8H2,3-5H3;2H,1H3/b10-9+; |
| InChIKey | HNXYVYSHGRRANJ-RRABGKBLSA-N |
| XLogP | 2.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|