C10H17NS — CID 134988149
(2Z)-N,N-diethyl-2-methylpenta-2,4-dienethioamide (PubChem CID 134988149) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is (2Z)-N,N-diethyl-2-methylpenta-2,4-dienethioamide.
| Compound Name | (2Z)-N,N-diethyl-2-methylpenta-2,4-dienethioamide |
|---|---|
| PubChem CID | 134988149 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (2Z)-N,N-diethyl-2-methylpenta-2,4-dienethioamide |
| SMILES | C=C/C=C(/C)C(=S)N(CC)CC |
| InChI | InChI=1S/C10H17NS/c1-5-8-9(4)10(12)11(6-2)7-3/h5,8H,1,6-7H2,2-4H3/b9-8- |
| InChIKey | DXMSJAHSQISODT-HJWRWDBZSA-N |
| XLogP | 2.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|