C14H23NS — CID 138726522
(2E,5Z)-6-ethenyl-N,N,2-trimethylnona-2,5-dienethioamide (PubChem CID 138726522) has the molecular formula C14H23NS and a molecular weight of 237.41 g/mol. Its IUPAC name is (2E,5Z)-6-ethenyl-N,N,2-trimethylnona-2,5-dienethioamide.
| Compound Name | (2E,5Z)-6-ethenyl-N,N,2-trimethylnona-2,5-dienethioamide |
|---|---|
| PubChem CID | 138726522 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | (2E,5Z)-6-ethenyl-N,N,2-trimethylnona-2,5-dienethioamide |
| SMILES | C=C/C(=C\C/C=C(\C)C(=S)N(C)C)CCC |
| InChI | InChI=1S/C14H23NS/c1-6-9-13(7-2)11-8-10-12(3)14(16)15(4)5/h7,10-11H,2,6,8-9H2,1,3-5H3/b12-10+,13-11+ |
| InChIKey | JQZAPHCEPWUITK-DCIPZJNNSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|