C9H14ClF2O3P — CID 134922782
3-chloro-1-di(propan-2-yloxy)phosphoryl-3,3-difluoroprop-1-yne (PubChem CID 134922782) has the molecular formula C9H14ClF2O3P and a molecular weight of 274.63 g/mol. Its IUPAC name is 3-chloro-1-di(propan-2-yloxy)phosphoryl-3,3-difluoroprop-1-yne.
| Compound Name | 3-chloro-1-di(propan-2-yloxy)phosphoryl-3,3-difluoroprop-1-yne |
|---|---|
| PubChem CID | 134922782 |
| Molecular Formula | C9H14ClF2O3P |
| Molecular Weight | 274.63 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 3-chloro-1-di(propan-2-yloxy)phosphoryl-3,3-difluoroprop-1-yne |
| SMILES | CC(C)OP(=O)(C#CC(F)(F)Cl)OC(C)C |
| InChI | InChI=1S/C9H14ClF2O3P/c1-7(2)14-16(13,15-8(3)4)6-5-9(10,11)12/h7-8H,1-4H3 |
| InChIKey | SOYAKYFNTMAHLI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|