C12H25NS — CID 134923136
(E)-N,N-diethyl-1-ethylsulfanylhex-1-en-1-amine (PubChem CID 134923136) has the molecular formula C12H25NS and a molecular weight of 215.41 g/mol. Its IUPAC name is (E)-N,N-diethyl-1-ethylsulfanylhex-1-en-1-amine.
| Compound Name | (E)-N,N-diethyl-1-ethylsulfanylhex-1-en-1-amine |
|---|---|
| PubChem CID | 134923136 |
| Molecular Formula | C12H25NS |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (E)-N,N-diethyl-1-ethylsulfanylhex-1-en-1-amine |
| SMILES | CCCC/C=C(/SCC)N(CC)CC |
| InChI | InChI=1S/C12H25NS/c1-5-9-10-11-12(14-8-4)13(6-2)7-3/h11H,5-10H2,1-4H3/b12-11+ |
| InChIKey | MGUZWNSKSIYTIQ-VAWYXSNFSA-N |
| XLogP | 4.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|