About (E)-1-ethylsulfanyl-N,N-dimethylbut-1-en-1-amine
(E)-1-ethylsulfanyl-N,N-dimethylbut-1-en-1-amine (PubChem CID 134923273) has the molecular formula C8H17NS
and a molecular weight of 159.30 g/mol. Its IUPAC name is (E)-1-ethylsulfanyl-N,N-dimethylbut-1-en-1-amine.
Analyze (E)-1-ethylsulfanyl-N,N-dimethylbut-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-ethylsulfanyl-N,N-dimethylbut-1-en-1-amine?
The IUPAC name of (E)-1-ethylsulfanyl-N,N-dimethylbut-1-en-1-amine (CID 134923273) is (E)-1-ethylsulfanyl-N,N-dimethylbut-1-en-1-amine.
What is the SMILES notation for (E)-1-ethylsulfanyl-N,N-dimethylbut-1-en-1-amine?
The canonical SMILES for (E)-1-ethylsulfanyl-N,N-dimethylbut-1-en-1-amine is CC/C=C(/SCC)N(C)C.
What is the InChIKey of (E)-1-ethylsulfanyl-N,N-dimethylbut-1-en-1-amine?
The InChIKey is RUJYGQFWICHQGN-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H17NS/c1-5-7-8(9(3)4)10-6-2/h7H,5-6H2,1-4H3/b8-7+.
What are the key properties of (E)-1-ethylsulfanyl-N,N-dimethylbut-1-en-1-amine?
(E)-1-ethylsulfanyl-N,N-dimethylbut-1-en-1-amine has a molecular weight of 159.30 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-ethylsulfanyl-N,N-dimethylbut-1-en-1-amine is sourced from PubChem (CID 134923273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).