About N-ethyl-N-methyl-3,4-dihydro-2H-thiopyran-6-amine
N-ethyl-N-methyl-3,4-dihydro-2H-thiopyran-6-amine (PubChem CID 142050819) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is N-ethyl-N-methyl-3,4-dihydro-2H-thiopyran-6-amine.
Analyze N-ethyl-N-methyl-3,4-dihydro-2H-thiopyran-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-3,4-dihydro-2H-thiopyran-6-amine?
The IUPAC name of N-ethyl-N-methyl-3,4-dihydro-2H-thiopyran-6-amine (CID 142050819) is N-ethyl-N-methyl-3,4-dihydro-2H-thiopyran-6-amine.
What is the SMILES notation for N-ethyl-N-methyl-3,4-dihydro-2H-thiopyran-6-amine?
The canonical SMILES for N-ethyl-N-methyl-3,4-dihydro-2H-thiopyran-6-amine is CCN(C)C1=CCCCS1.
What is the InChIKey of N-ethyl-N-methyl-3,4-dihydro-2H-thiopyran-6-amine?
The InChIKey is HPEXKNXMIOMTRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-3-9(2)8-6-4-5-7-10-8/h6H,3-5,7H2,1-2H3.
What are the key properties of N-ethyl-N-methyl-3,4-dihydro-2H-thiopyran-6-amine?
N-ethyl-N-methyl-3,4-dihydro-2H-thiopyran-6-amine has a molecular weight of 157.28 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-3,4-dihydro-2H-thiopyran-6-amine is sourced from PubChem (CID 142050819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).