About N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine
N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine (PubChem CID 142050904) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine.
Molecular Properties
| Compound Name | N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine |
| PubChem CID | 142050904 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine |
| SMILES | CCN(C)C1=C=CCCS1 |
| InChI | InChI=1S/C8H13NS/c1-3-9(2)8-6-4-5-7-10-8/h4H,3,5,7H2,1-2H3 |
| InChIKey | SLAVOALACFEFNO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine?
The IUPAC name of N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine (CID 142050904) is N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine.
What is the SMILES notation for N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine?
The canonical SMILES for N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine is CCN(C)C1=C=CCCS1.
What is the InChIKey of N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine?
The InChIKey is SLAVOALACFEFNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS/c1-3-9(2)8-6-4-5-7-10-8/h4H,3,5,7H2,1-2H3.
What are the key properties of N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine?
N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine has a molecular weight of 155.27 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-2,3-dihydrothiopyran-6-amine is sourced from PubChem (CID 142050904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).