About 6-ethylsulfanyl-1-methyl-3,4-dihydro-2H-pyridine
6-ethylsulfanyl-1-methyl-3,4-dihydro-2H-pyridine (PubChem CID 123995452) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is 6-ethylsulfanyl-1-methyl-3,4-dihydro-2H-pyridine.
Analyze 6-ethylsulfanyl-1-methyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethylsulfanyl-1-methyl-3,4-dihydro-2H-pyridine?
The IUPAC name of 6-ethylsulfanyl-1-methyl-3,4-dihydro-2H-pyridine (CID 123995452) is 6-ethylsulfanyl-1-methyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 6-ethylsulfanyl-1-methyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for 6-ethylsulfanyl-1-methyl-3,4-dihydro-2H-pyridine is CCSC1=CCCCN1C.
What is the InChIKey of 6-ethylsulfanyl-1-methyl-3,4-dihydro-2H-pyridine?
The InChIKey is ZKTNXTMXKFFPON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-3-10-8-6-4-5-7-9(8)2/h6H,3-5,7H2,1-2H3.
What are the key properties of 6-ethylsulfanyl-1-methyl-3,4-dihydro-2H-pyridine?
6-ethylsulfanyl-1-methyl-3,4-dihydro-2H-pyridine has a molecular weight of 157.28 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethylsulfanyl-1-methyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 123995452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).