C20H23O5PS — CID 134923253
[(1E,3Z)-4-(benzenesulfonyl)-4-diethoxyphosphorylbuta-1,3-dienyl]benzene (PubChem CID 134923253) has the molecular formula C20H23O5PS and a molecular weight of 406.44 g/mol. Its IUPAC name is [(1E,3Z)-4-(benzenesulfonyl)-4-diethoxyphosphorylbuta-1,3-dienyl]benzene.
| Compound Name | [(1E,3Z)-4-(benzenesulfonyl)-4-diethoxyphosphorylbuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 134923253 |
| Molecular Formula | C20H23O5PS |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [(1E,3Z)-4-(benzenesulfonyl)-4-diethoxyphosphorylbuta-1,3-dienyl]benzene |
| SMILES | CCOP(=O)(OCC)/C(=C/C=C/c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23O5PS/c1-3-24-26(21,25-4-2)20(17-11-14-18-12-7-5-8-13-18)27(22,23)19-15-9-6-10-16-19/h5-17H,3-4H2,1-2H3/b14-11+,20-17- |
| InChIKey | GDPLZCZQXWVUEY-DBAYFNDFSA-N |
| XLogP | 5.28 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|