C16H28N2 — CID 134923782
(1Z)-1-N,1-N-diethyl-4-methyl-1-N',1-N'-bis(prop-2-enyl)penta-1,3-diene-1,1-diamine (PubChem CID 134923782) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is (1Z)-1-N,1-N-diethyl-4-methyl-1-N',1-N'-bis(prop-2-enyl)penta-1,3-diene-1,1-diamine.
| Compound Name | (1Z)-1-N,1-N-diethyl-4-methyl-1-N',1-N'-bis(prop-2-enyl)penta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 134923782 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | (1Z)-1-N,1-N-diethyl-4-methyl-1-N',1-N'-bis(prop-2-enyl)penta-1,3-diene-1,1-diamine |
| SMILES | C=CCN(CC=C)/C(=C\C=C(C)C)N(CC)CC |
| InChI | InChI=1S/C16H28N2/c1-7-13-18(14-8-2)16(12-11-15(5)6)17(9-3)10-4/h7-8,11-12H,1-2,9-10,13-14H2,3-6H3/b16-12- |
| InChIKey | ZREBSCBFTJCORU-VBKFSLOCSA-N |
| XLogP | 3.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|