C12H22N2 — CID 56630542
1-methyl-N,N-di(propan-2-yl)-2H-pyridin-6-amine (PubChem CID 56630542) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-methyl-N,N-di(propan-2-yl)-2H-pyridin-6-amine.
| Compound Name | 1-methyl-N,N-di(propan-2-yl)-2H-pyridin-6-amine |
|---|---|
| PubChem CID | 56630542 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-methyl-N,N-di(propan-2-yl)-2H-pyridin-6-amine |
| SMILES | CC(C)N(C1=CC=CCN1C)C(C)C |
| InChI | InChI=1S/C12H22N2/c1-10(2)14(11(3)4)12-8-6-7-9-13(12)5/h6-8,10-11H,9H2,1-5H3 |
| InChIKey | SAHOPVVRXKFSGH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |