C10H18N2 — CID 56625560
N,N-dimethyl-1-propan-2-yl-2H-pyridin-6-amine (PubChem CID 56625560) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N,N-dimethyl-1-propan-2-yl-2H-pyridin-6-amine.
| Compound Name | N,N-dimethyl-1-propan-2-yl-2H-pyridin-6-amine |
|---|---|
| PubChem CID | 56625560 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N,N-dimethyl-1-propan-2-yl-2H-pyridin-6-amine |
| SMILES | CC(C)N1CC=CC=C1N(C)C |
| InChI | InChI=1S/C10H18N2/c1-9(2)12-8-6-5-7-10(12)11(3)4/h5-7,9H,8H2,1-4H3 |
| InChIKey | QXEAMCGZOKRHJU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |