C14H9NO2 — CID 134923817
4-(1H-indol-3-yl)cyclohexa-3,5-diene-1,2-dione (PubChem CID 134923817) has the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-(1H-indol-3-yl)cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 134923817 |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 4-(1H-indol-3-yl)cyclohexa-3,5-diene-1,2-dione |
| SMILES | O=C1C=CC(c2c[nH]c3ccccc23)=CC1=O |
| InChI | InChI=1S/C14H9NO2/c16-13-6-5-9(7-14(13)17)11-8-15-12-4-2-1-3-10(11)12/h1-8,15H |
| InChIKey | JKNXUNNCTQXBAS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|