C15H12N2O2 — CID 147915337
3-(5-nitrocyclohepta-1,3,6-trien-1-yl)-1H-indole (PubChem CID 147915337) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-(5-nitrocyclohepta-1,3,6-trien-1-yl)-1H-indole.
| Compound Name | 3-(5-nitrocyclohepta-1,3,6-trien-1-yl)-1H-indole |
|---|---|
| PubChem CID | 147915337 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-(5-nitrocyclohepta-1,3,6-trien-1-yl)-1H-indole |
| SMILES | O=[N+]([O-])C1C=CC=C(c2c[nH]c3ccccc23)C=C1 |
| InChI | InChI=1S/C15H12N2O2/c18-17(19)12-5-3-4-11(8-9-12)14-10-16-15-7-2-1-6-13(14)15/h1-10,12,16H |
| InChIKey | IGYJOVCDJVWNCC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|