C14H8BrNO2 — CID 174587798
2-bromo-5-(1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 174587798) has the molecular formula C14H8BrNO2 and a molecular weight of 302.13 g/mol. Its IUPAC name is 2-bromo-5-(1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-bromo-5-(1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 174587798 |
| Molecular Formula | C14H8BrNO2 |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 2-bromo-5-(1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(c2c[nH]c3ccccc23)C(=O)C=C1Br |
| InChI | InChI=1S/C14H8BrNO2/c15-11-6-13(17)9(5-14(11)18)10-7-16-12-4-2-1-3-8(10)12/h1-7,16H |
| InChIKey | RLTMBMQJXHKKNO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|