C19H23N — CID 134924303
(2S,3S,4S)-1-ethyl-2-methyl-3,4-diphenylpyrrolidine (PubChem CID 134924303) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is (2S,3S,4S)-1-ethyl-2-methyl-3,4-diphenylpyrrolidine.
| Compound Name | (2S,3S,4S)-1-ethyl-2-methyl-3,4-diphenylpyrrolidine |
|---|---|
| PubChem CID | 134924303 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (2S,3S,4S)-1-ethyl-2-methyl-3,4-diphenylpyrrolidine |
| SMILES | CCN1C[C@H](c2ccccc2)[C@@H](c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C19H23N/c1-3-20-14-18(16-10-6-4-7-11-16)19(15(20)2)17-12-8-5-9-13-17/h4-13,15,18-19H,3,14H2,1-2H3/t15-,18+,19+/m0/s1 |
| InChIKey | QVFWRVAVJLYVDS-KFKAGJAMSA-N |
| XLogP | 4.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |