C28H32N2O9 — CID 134925426
dimethyl (E)-2-[2-acetyl-3-[(1S,2S)-2-hydroxy-1,3-bis(phenylmethoxy)propyl]-5-oxopyrazolidin-1-yl]but-2-enedioate (PubChem CID 134925426) has the molecular formula C28H32N2O9 and a molecular weight of 540.57 g/mol. Its IUPAC name is dimethyl (E)-2-[2-acetyl-3-[(1S,2S)-2-hydroxy-1,3-bis(phenylmethoxy)propyl]-5-oxopyrazolidin-1-yl]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-acetyl-3-[(1S,2S)-2-hydroxy-1,3-bis(phenylmethoxy)propyl]-5-oxopyrazolidin-1-yl]but-2-enedioate |
|---|---|
| PubChem CID | 134925426 |
| Molecular Formula | C28H32N2O9 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | dimethyl (E)-2-[2-acetyl-3-[(1S,2S)-2-hydroxy-1,3-bis(phenylmethoxy)propyl]-5-oxopyrazolidin-1-yl]but-2-enedioate |
| SMILES | COC(=O)/C=C(\C(=O)OC)N1C(=O)CC([C@H](OCc2ccccc2)[C@@H](O)COCc2ccccc2)N1C(C)=O |
| InChI | InChI=1S/C28H32N2O9/c1-19(31)29-22(14-25(33)30(29)23(28(35)37-3)15-26(34)36-2)27(39-17-21-12-8-5-9-13-21)24(32)18-38-16-20-10-6-4-7-11-20/h4-13,15,22,24,27,32H,14,16-18H2,1-3H3/b23-15+/t22?,24-,27-/m0/s1 |
| InChIKey | JETDMHNDKZSEHG-TYQGSFKYSA-N |
| XLogP | 1.74 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|