C23H22BrN3O7 — CID 134925731
trimethyl (3S)-2-benzyl-1-[(4-bromophenyl)carbamoyl]-3H-pyrazole-3,4,5-tricarboxylate (PubChem CID 134925731) has the molecular formula C23H22BrN3O7 and a molecular weight of 532.35 g/mol. Its IUPAC name is trimethyl (3S)-2-benzyl-1-[(4-bromophenyl)carbamoyl]-3H-pyrazole-3,4,5-tricarboxylate.
| Compound Name | trimethyl (3S)-2-benzyl-1-[(4-bromophenyl)carbamoyl]-3H-pyrazole-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 134925731 |
| Molecular Formula | C23H22BrN3O7 |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 531.06 |
| IUPAC Name | trimethyl (3S)-2-benzyl-1-[(4-bromophenyl)carbamoyl]-3H-pyrazole-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(C(=O)Nc2ccc(Br)cc2)N(Cc2ccccc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C23H22BrN3O7/c1-32-20(28)17-18(21(29)33-2)26(13-14-7-5-4-6-8-14)27(19(17)22(30)34-3)23(31)25-16-11-9-15(24)10-12-16/h4-12,18H,13H2,1-3H3,(H,25,31)/t18-/m0/s1 |
| InChIKey | ITAHOBMPXMEZJW-SFHVURJKSA-N |
| XLogP | 2.86 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|