C15H23F3O4S2Si — CID 134926043
[3-phenyl-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate (PubChem CID 134926043) has the molecular formula C15H23F3O4S2Si and a molecular weight of 416.56 g/mol. Its IUPAC name is [3-phenyl-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate.
| Compound Name | [3-phenyl-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134926043 |
| Molecular Formula | C15H23F3O4S2Si |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | [3-phenyl-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)CS1(OS(=O)(=O)C(F)(F)F)CCOCC1c1ccccc1 |
| InChI | InChI=1S/C15H23F3O4S2Si/c1-25(2,3)12-23(22-24(19,20)15(16,17)18)10-9-21-11-14(23)13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3 |
| InChIKey | JYNXZJPOWGLDLD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|