C15H21F3OS2Si — CID 101135321
O-(2-phenylethyl) (3,3,3-trifluoro-1-trimethylsilylpropyl)sulfanylmethanethioate (PubChem CID 101135321) has the molecular formula C15H21F3OS2Si and a molecular weight of 366.55 g/mol. Its IUPAC name is O-(2-phenylethyl) (3,3,3-trifluoro-1-trimethylsilylpropyl)sulfanylmethanethioate.
| Compound Name | O-(2-phenylethyl) (3,3,3-trifluoro-1-trimethylsilylpropyl)sulfanylmethanethioate |
|---|---|
| PubChem CID | 101135321 |
| Molecular Formula | C15H21F3OS2Si |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | O-(2-phenylethyl) (3,3,3-trifluoro-1-trimethylsilylpropyl)sulfanylmethanethioate |
| SMILES | C[Si](C)(C)C(CC(F)(F)F)SC(=S)OCCc1ccccc1 |
| InChI | InChI=1S/C15H21F3OS2Si/c1-22(2,3)13(11-15(16,17)18)21-14(20)19-10-9-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3 |
| InChIKey | MHKKHIKCVPSVAW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|