C19H29NO — CID 134926128
N-(1-phenylbutoxy)-N-prop-2-enylhex-5-en-2-amine (PubChem CID 134926128) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is N-(1-phenylbutoxy)-N-prop-2-enylhex-5-en-2-amine.
| Compound Name | N-(1-phenylbutoxy)-N-prop-2-enylhex-5-en-2-amine |
|---|---|
| PubChem CID | 134926128 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | N-(1-phenylbutoxy)-N-prop-2-enylhex-5-en-2-amine |
| SMILES | C=CCCC(C)N(CC=C)OC(CCC)c1ccccc1 |
| InChI | InChI=1S/C19H29NO/c1-5-8-13-17(4)20(16-7-3)21-19(12-6-2)18-14-10-9-11-15-18/h5,7,9-11,14-15,17,19H,1,3,6,8,12-13,16H2,2,4H3 |
| InChIKey | WPQWFYMPLUJRKD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|