C19H17F6NO2 — CID 134927270
N-[(E)-3-[4-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]but-2-enyl]hydroxylamine (PubChem CID 134927270) has the molecular formula C19H17F6NO2 and a molecular weight of 405.34 g/mol. Its IUPAC name is N-[(E)-3-[4-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]but-2-enyl]hydroxylamine.
| Compound Name | N-[(E)-3-[4-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]but-2-enyl]hydroxylamine |
|---|---|
| PubChem CID | 134927270 |
| Molecular Formula | C19H17F6NO2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-[(E)-3-[4-[[3,5-bis(trifluoromethyl)phenoxy]methyl]phenyl]but-2-enyl]hydroxylamine |
| SMILES | C/C(=C\CNO)c1ccc(COc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H17F6NO2/c1-12(6-7-26-27)14-4-2-13(3-5-14)11-28-17-9-15(18(20,21)22)8-16(10-17)19(23,24)25/h2-6,8-10,26-27H,7,11H2,1H3/b12-6+ |
| InChIKey | QEICQHBAAHKNFR-WUXMJOGZSA-N |
| XLogP | 5.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|